| Identification | |
| Name: | Propionyl bromide |
| Synonyms: | - |
| CAS: | 598-22-1 |
| EINECS: | 209-924-0 |
| Molecular Formula: | C3H5BrO |
| Molecular Weight: | 136.98 |
| InChI: | InChI=1/C3H5BrO/c1-2-3(4)5/h2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2920 |
| Melting Point: | -40 |
| Flash Point: | 126? |
| Density: | 1.521 |
| Stability: | Stable under normal conditions. |
| Refractive index: | 1.455 |
| Solubility: | Decomposes |
| Appearance: | Colorless liquid with a pungent odor. |
| Specification: |
Propionyl bromide , with CAS number of 598-22-1, can be called Propanoyl bromide;Propionic acid bromide;1-Bromo-1-propanone ; Propanoic acid bromide ; Propionyl bromide,95% ; Propionylbromide (6CI,7CI,8CI) . Chemical Properties of Propionyl Bromide(598-22-1) is a light yellow to brown liquid, fuming with moisture, so need to be stored in a dry, cool, well-ventilated area. Soluble in ether, decomposition with water or alcohol. Its main purpose is to make pharmaceutical intermediates for organic synthesis, obtained by the anhydrous acid reaction with bromine in the condition of red phosphorus. |
| Packinggroup: | III |
| Flash Point: | 126? |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
