Identification |
Name: | propionyl chloride |
Synonyms: | Propanoyl chloride |
CAS: | 79-03-8 |
EINECS: | 201-170-0 |
Molecular Formula: | C3H5ClO |
Molecular Weight: | 92.52 |
InChI: | InChI=1/C3H5ClO/c1-2-3(4)5/h2H2,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 1815 |
Density: | 1.06 |
Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
Refractive index: | 1.402-1.405 |
Water Solubility: | REACTS |
Solubility: | REACTS in water |
Appearance: | colorless liquid with a pungent odor |
Specification: |
?Propionyl chloride (CAS NO.79-03-8), its Synonyms are Propionic acid chloride ; Propionic chloride ; Propanoyl chloride .
|
Report: |
Reported in EPA TSCA Inventory.
|
Packinggroup: | II |
HS Code: | 29051900 |
Storage Temperature: | Flammables area |
Sensitive: | Moisture Sensitive |
Usage: | Alkaloid. |
Safety Data |
Hazard Symbols |
C:Corrosive
|
|
 |