| Identification | |
| Name: | p-Iodobenzyl isobutyl carbonate |
| Synonyms: | p-Iodobenzylisobutyl=carbonate |
| CAS: | 60075-65-2 |
| Molecular Formula: | C12H15IO3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H15IO3/c1-9(2)7-15-12(14)16-8-10-3-5-11(13)6-4-10/h3-6,9H,7-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 157.2°C |
| Boiling Point: | 336.3°C at 760 mmHg |
| Density: | 1.514g/cm3 |
| Refractive index: | 1.554 |
| Specification: |
p-Iodobenzyl isobutyl carbonate , its cas register number is 60075-65-2. It also can be called BRN 1969625 ; Carbonic acid, (4-iodophenyl)methyl 2-methylpropyl ester .When p-Iodobenzyl isobutyl carbonate (CAS NO.60075-65-2) is heated to decomposition, it emits toxic vapors of I−. |
| Flash Point: | 157.2°C |
| Safety Data | |
 |
|
