| Identification | |
| Name: | n-Hexyl p-iodobenzyl carbonate |
| Synonyms: | Hexyl p-iodobenzyl=carbonate |
| CAS: | 60075-68-5 |
| Molecular Formula: | C14H19IO3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C14H19IO3/c1-2-3-4-5-10-17-14(16)18-11-12-6-8-13(15)9-7-12/h6-9H,2-5,10-11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 178.5°C |
| Boiling Point: | 371.6°C at 760 mmHg |
| Density: | 1.43g/cm3 |
| Refractive index: | 1.544 |
| Specification: |
n-Hexyl p-iodobenzyl carbonate , its cas register number is 60075-68-5. It also can be called Carbonic acid, hexyl p-iodobenzyl ester ; and Carbonic acid, hexyl (4-iodophenyl)methyl ester . |
| Flash Point: | 178.5°C |
| Safety Data | |
 |
|
