| Identification | |
| Name: | (2-(Ethoxycarbonyl)-1-methyl)ethyl carbonic acid-p-iodobenzyl ester |
| Synonyms: | Carbonic acid 2-ethoxycarbonyl-1-methylethyl 4-iodobenzyl ester |
| CAS: | 60075-74-3 |
| Molecular Formula: | C14H17IO5 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C14H17IO5/c1-3-18-13(16)8-10(2)20-14(17)19-9-11-4-6-12(15)7-5-11/h4-7,10H,3,8-9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 201.7°C |
| Boiling Point: | 409.8°C at 760 mmHg |
| Density: | 1.525g/cm3 |
| Refractive index: | 1.548 |
| Specification: |
(2-(Ethoxycarbonyl)-1-methyl)ethyl carbonic acid-p-iodobenzyl ester with cas registry number of 60075-74-3 is also known as Carbonic acid 2-ethoxycarbonyl-1-methylethyl 4-iodobenzyl ester . |
| Flash Point: | 201.7°C |
| Safety Data | |
 |
|
