| Identification | |
| Name: | Carbonic acid, butyl ester, ester with 2-(p-iodobenzyl)butanol |
| Synonyms: | Carbonic acid butyl 2-(p-iodobenzyl)butyl ester |
| CAS: | 60075-86-7 |
| Molecular Formula: | C16H23IO3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C16H23IO3/c1-3-5-10-19-16(18)20-12-13(4-2)11-14-6-8-15(17)9-7-14/h6-9,13H,3-5,10-12H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 194.4°C |
| Boiling Point: | 397.9°C at 760 mmHg |
| Density: | 1.361g/cm3 |
| Refractive index: | 1.535 |
| Specification: |
Carbonic acid, butyl ester, ester with 2-(p-iodobenzyl)butanol , its cas register number is 60075-86-7. It also can be called Carbonic acid, butyl 3-(p-iodophenyl)propyl ester . |
| Flash Point: | 194.4°C |
| Safety Data | |
 |
|
