| Identification | |
| Name: | 5-Nitroacenaphthene |
| Synonyms: | - |
| CAS: | 602-87-9 |
| EINECS: | 210-025-0 |
| Molecular Formula: | C12H9NO2 |
| Molecular Weight: | 199.20536 |
| InChI: | InChI=1S/C12H9NO2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-3,6-7H,4-5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Boiling Point: | 279°C |
| Density: | 1.408g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.763 |
| Water Solubility: | negligible Stability Stable. Combustible. Incompatible with strongoxidizing agents. Toxicology Experimental carcinogen. IARC possible humancarcinogen. Harmful if swallowed or inhaled. |
| Solubility: | negligible Stability Stable. Combustible. Incompatible with strongoxidizing agents. Toxicology Experimental carcinogen. IARC possible humancarcinogen. Harmful if swallowed or inhaled. |
| Appearance: | yellow powder |
| Specification: | yellow powder Safety Statements:53-45 53:Avoid exposure - obtain special instruction before use 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | O53 |
| Color: | Solid |
| Safety Data | |
 |
|
