| Identification | |
| Name: | 4-Pentynoic acid |
| Synonyms: | Propargylaceticacid; |
| CAS: | 6089-09-4 |
| EINECS: | 228-028-0 |
| Molecular Formula: | C5H6O2 |
| Molecular Weight: | 98.09994 |
| InChI: | InChI=1S/C5H6O2/c1-2-3-4-5(6)7/h1H,3-4H2,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 292 |
| Melting Point: | 56 - 60 C |
| Flash Point: | 75 °C |
| Boiling Point: | 110 °C30 mm Hg(lit.) |
| Density: | 1.096g/cm3 |
| Water Solubility: | Soluble AUTOIGNITION |
| Solubility: | Soluble
AUTOIGNITION
Appearance:white to off-white crystalline powder Transport Information: 292 Hazard Symbols:8, 6.1 (Packing Group: II) UN NO. |
| Appearance: | white to off-white crystalline powder |
| Specification: | white to beige crystalline powder or flakes usageEng:4-Pentynoic Acid is a hypoglycemic agent shown to increase liver tyrosine aminotransferase and plasma corticosterone while decreasing blood sugar in rats. Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 75 °C |
| Storage Temperature: | 2-8°C |
| Usage: | 4-Pentynoic Acid is a hypoglycemic agent shown to increase liver tyrosine aminotransferase and plasma corticosterone while decreasing blood sugar in rats. |
| Safety Data | |
| Hazard Symbols |
8, 6.1 (Packing Group: II)
UN
NO.
|
 |
|
