Identification |
Name: | Benzene,1,2-dibromo-4-methyl- |
Synonyms: | Toluene,3,4-dibromo- (5CI); 1,2-Dibromo-4-methylbenzene; 3,4-Dibromotoluene; NSC 139879 |
CAS: | 60956-23-2 |
EINECS: | -0 |
Molecular Formula: | C7H6 Br2 |
Molecular Weight: | 249.9305 |
InChI: | InChI=1S/C7H6Br2/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3 |
Molecular Structure: |
 |
Properties |
Density: | 1,85 g/cm3 |
Refractive index: | 1.5985-1.6005 |
Appearance: | clear colorless to yellow liquid |
Specification: | clear colorless to yellow liquid Safety Statements:37/39-26 37/39:Wear suitable protective clothing, gloves and eye/face
protection 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |