| Identification | |
| Name: | Benzene,1,2-dibromo-4-methyl- |
| Synonyms: | Toluene,3,4-dibromo- (5CI); 1,2-Dibromo-4-methylbenzene; 3,4-Dibromotoluene; NSC 139879 |
| CAS: | 60956-23-2 |
| EINECS: | -0 |
| Molecular Formula: | C7H6 Br2 |
| Molecular Weight: | 249.9305 |
| InChI: | InChI=1S/C7H6Br2/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1,85 g/cm3 |
| Refractive index: | 1.5985-1.6005 |
| Appearance: | clear colorless to yellow liquid |
| Specification: | clear colorless to yellow liquid Safety Statements:37/39-26 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
