| Identification | |
| Name: | 5-Nitroisatin |
| Synonyms: | Indole-2,3-dione,5-nitro- (8CI);Isatin, 5-nitro- (6CI);5-Nitro-1H-indole-2,3-dione;5-Nitro-2,3-indolinedione;5-Nitroindole-2,3-dione;1H-Indole-2,3-dione,5-nitro-;5-Nitrosotin;NSC 525798; |
| CAS: | 611-09-6 |
| EINECS: | 210-252-5 |
| Molecular Formula: | C8H4N2O4 |
| Molecular Weight: | 192.13 |
| InChI: | InChI=1/C8H4N2O4/c11-7-5-3-4(10(13)14)1-2-6(5)9-8(7)12/h1-3H,(H,9,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.609 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.657 |
| Solubility: | Soluble |
| Appearance: | orange-yellow to orange crystalline powder |
| Specification: |
5-Nitroisatin (CAS NO.611-09-6) is also named as 5-21-10-00267 (Beilstein Handbook Reference) ; 5-Nitro-1H-indole-2,3-dione ; 5-Nitroindole-2,3-dione ; BRN 0180223 ; CCRIS 4031 ; Isatin, 5-nitro- (6CI) ; NSC 525798 ; 1H-Indole-2,3-dione, 5-nitro- (9CI) ; 2,3-Dihydro-5-nitroindole-2,3-dione ; Indole-2,3-dione, 5-nitro- . 5-Nitroisatin (CAS NO.611-09-6) is orange-yellow to orange crystalline powder. |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
