| Identification | |
| Name: | 2-Hydroxyphenylacetic acid |
| Synonyms: | Aceticacid, (o-hydroxyphenyl)- (8CI);(2-Hydroxyphenyl)acetic acid;(o-Hydroxyphenyl)acetic acid;2-HPAA;Benzeneaceticacid, 2-hydroxy-;NSC 62000; |
| CAS: | 614-75-5 |
| EINECS: | 210-393-2 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.14732 |
| InChI: | InChI=1S/C8H8O3/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4,9H,5H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.321 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | off-white solid |
| Specification: |
?2-Hydroxyphenylacetic acid (CAS NO.614-75-5) is also named?as?(2-Hydroxyphenyl)acetic acid ; 2-Hydroxybenzeneacetic acid ; 2-Hydroxyphenylacetate ; 2-Hydroxyphenylacetic acid ; Hydroxyphenylacetic acid ; NSC 62000 ; o-Hydroxy phenylacetic acid ; o-Hydroxyphenylacetic acid?.?2-Hydroxyphenylacetic acid (CAS NO.614-75-5) is off-white solid.?It insoluble in water, soluble in benzene, toluene and other organic solvents. |
| HS Code: | 29182990 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
