| Identification |
| Name: | 1-Butanamine, 2-ethyl- |
| Synonyms: | Butylamine,2-ethyl- (6CI,8CI); (2-Ethyl-n-butyl)amine; 1-Amino-2-ethylbutane;2-Ethyl-1-butanamine; 2-Ethylbutylamine |
| CAS: | 617-79-8 |
| EINECS: | 205-565-9 |
| Molecular Formula: | C6H15 N |
| Molecular Weight: | 101.19 |
| InChI: | InChI=1/C6H15N/c1-3-6(4-2)5-7/h6H,3-5,7H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2733 |
| Flash Point: | 14 °C |
| Boiling Point: | 125 |
| Density: | 0.776 |
| Refractive index: | 1.42 |
| Solubility: | Soluble in methyl and ethyl alcohols, ethyl ether, ethyl acetate, acetone, aromatic and aliphatic hydrocarbons, fixed oils, mineral oil, oleic and stearic acids. |
| Packinggroup: | II |
| Flash Point: | 14 °C |
| Storage Temperature: | Flammables area |
| Color: | Water-white liquid |
| Safety Data |
| Hazard Symbols |
C-F,F,C:
|
| |
 |
