| Identification | |
| Name: | Benzenemethanol,3-nitro- |
| Synonyms: | Benzyl alcohol,m-nitro- (6CI,7CI,8CI);(3-Nitrophenyl)methanol;3-Nitrobenzenemethanol;3-Nitrobenzyl alcohol;NSC 5388;m-Nitrobenzyl alcohol; |
| CAS: | 619-25-0 |
| EINECS: | 210-588-2 |
| Molecular Formula: | C7H7NO3 |
| Molecular Weight: | 153.14 |
| InChI: | InChI=1/C7H7NO3/c9-5-6-2-1-3-7(4-6)8(10)11/h1-4,9H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.29 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5730 |
| Solubility: | Slightly soluble |
| Appearance: | clear yellow brown liquid. |
| Specification: | yellow to brown crystalline low melting solid Safety Statements:24/25-45-36/37/39-26-16 24/25:Avoid contact with skin and eyes 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 16:Keep away from sources of ignition - No smoking |
| HS Code: | 29062900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
