| Identification |
| Name: | 2-Bromo-4'-methylacetophenone |
| Synonyms: | alpha-Bromo-4-methylacetophenone; 4-Methylphenacyl bromide; 2-BROMO-4?METHYLACETOPHENONE; 2-Bromo-1-(4-methylphenyl)ethan-1-one; 4-Methyl Phenacyl bromide |
| CAS: | 619-41-0 |
| EINECS: | 210-595-0 |
| Molecular Formula: | C9H9BrO |
| Molecular Weight: | 213.07 |
| InChI: | InChI=1/C9H9BrO/c1-7-2-4-8(5-3-7)9(11)6-10/h2-5H,6H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 |
| Flash Point: | 74.4 ºC |
| Density: | 1.416 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Refractive index: | n20/D 1.528(lit.) |
| Solubility: | Insoluble |
| Appearance: | White to light yellow crystal powder |
| Flash Point: | 74.4 ºC |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
