Identification |
Name: | 4'-Hydroxy-3'-methylacetophenone |
Synonyms: | Acetophenone,4'-hydroxy-3'-methyl- (7CI,8CI);1-(3-Methyl-4-hydroxyphenyl)ethanone;1-(4-Hydroxy-3-methylphenyl)ethanone;2-Methyl-4-acetylphenol;3'-Methyl-4'-hydroxyacetophenone;4-Acetyl-2-methylphenol;Ethanone,1-(4-hydroxy-3-methylphenyl)-;NSC 63365;4-Hydroxy-3-methylacetophenone; |
CAS: | 876-02-8 |
EINECS: | 212-880-5 |
Molecular Formula: | C9H10O2 |
Molecular Weight: | 150.17 |
InChI: | InChI=1/C9H10O2/c1-6-5-8(7(2)10)3-4-9(6)11/h3-5,11H,1-2H3 |
Molecular Structure: |
 |
Properties |
Density: | 1.106 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.546 |
Appearance: | white to light beige crystalline powder |
Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |