| Identification | |
| Name: | 4-Dimethylaminobenzoic acid |
| Synonyms: | 4-dimethylamino benzoic acid |
| CAS: | 619-84-1 |
| EINECS: | 210-615-8 |
| Molecular Formula: | C9H11NO2 |
| Molecular Weight: | 165.18914 |
| InChI: | InChI=1S/C9H11NO2/c1-10(2)8-5-3-7(4-6-8)9(11)12/h3-6H,1-2H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.18 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1,3715 |
| Water Solubility: | Slight soluble SOLVENT Soluble in alcohol |
| Solubility: | Slight soluble SOLVENT Soluble in alcohol |
| Appearance: | White to yellowish crystalline powder |
| Specification: | light grey powder Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29224995 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
