| Identification | |
| Name: | 2-Dimethylaminobenzoic acid |
| Synonyms: | - |
| CAS: | 610-16-2 |
| EINECS: | 210-209-0 |
| Molecular Formula: | C9H11NO2 |
| Molecular Weight: | 165.19 |
| InChI: | InChI=1/C9H11NO2/c1-10(2)8-6-4-3-5-7(8)9(11)12/h3-6H,1-2H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 128.3°C |
| Boiling Point: | 288.5°C at 760 mmHg |
| Specification: | Safety Statements:26-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves |
| Flash Point: | 128.3°C |
| Safety Data | |
 |
|
