| Identification | |
| Name: | 2-Naphthoic acid |
| Synonyms: | 2-Naphthoicacid (8CI);2-Carboxynaphthalene;2-Maythic acid;2-Naphthylcarboxylic acid;Isonaphthoic acid;NSC 59901;b-Naphthalenecarboxylic acid;b-Naphthoic acid;2-Naphthalenecarboxylicacid; |
| CAS: | 93-09-4 |
| EINECS: | 202-217-8 |
| Molecular Formula: | C11H8O2 |
| Molecular Weight: | 172.18 |
| InChI: | InChI=1/C11H8O2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.265 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | <0.5 g/L (20 C) |
| Solubility: | 0.5 g/L |
| Appearance: | white to off white crystals |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
