| Identification | |
| Name: | 3-Amino-2-naphthoic acid |
| Synonyms: | - |
| CAS: | 5959-52-4 |
| EINECS: | 227-726-2 |
| Molecular Formula: | C11H9NO2 |
| Molecular Weight: | 187.19 |
| InChI: | InChI=1/C11H9NO2/c12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14/h1-6H,12H2,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 383 |
| Density: | 1.352 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Soluble |
| Appearance: | Yellow - green powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Substance is used in the determination of copper, nickel, cobalt. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
