| Identification | |
| Name: | 4-Ethoxyphenol |
| Synonyms: | Phenol,p-ethoxy- (6CI,7CI,8CI);Hydroquinoneethyl ether;Hydroquinone monoethyl ether;NSC 9885;p-Ethoxyphenol;p-Hydroxyphenetole; |
| CAS: | 622-62-8 |
| EINECS: | 210-748-1 |
| Molecular Formula: | C8H10O2 |
| Molecular Weight: | 138.16 |
| InChI: | InChI=1/C8H10O2/c1-2-10-8-5-3-7(9)4-6-8/h3-6,9H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 124 ºC |
| Density: | 1.076 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | Peach crystals. |
| Specification: |
4-Ethoxyphenol , its CAS NO. is 622-62-8, the synonyms are Ether monoethylique de l'hydroquinone ; Hydroquinone monoethyl ether ; Phenol, 4-ethoxy- ; Phenol, p-ethoxy- ; p-Ethoxyphenol ; p-Hydroxyphenetole . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 124 ºC |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
