| Identification | |
| Name: | 2-Ethoxyphenol |
| Synonyms: | Phenol,o-ethoxy- (6CI,7CI,8CI);1-Hydroxy-2-ethoxybenzene;Catecholmonoethyl ether;Pyrocatechol monoethyl ether;o-Ethoxyphenol;Guaethol; |
| CAS: | 94-71-3 |
| EINECS: | 202-358-5 |
| Molecular Formula: | C8H10O2 |
| Molecular Weight: | 138.16 |
| InChI: | InChI=1/C8H10O2/c1-2-10-8-6-4-3-5-7(8)9/h3-6,9H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.09 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.528-1.53 |
| Solubility: | 9 g/l (30 C) |
| Appearance: | clear colorless to yellow liquid |
| Specification: |
Guaethol , with CAS number of 94-71-3, can be called 2-Ethoxyphenol ; Catechol monoethyl ether ; o-Ethoxyphenol . It is a clear colorless to yellow liquid. |
| HS Code: | 29095090 |
| Storage Temperature: | Keep tightly closed. Keep away from heat and open flame. Store in a cool dry place. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
