| Identification | |
| Name: | Sulfurous acid, diethylester |
| Synonyms: | Ethylsulfite (6CI,7CI); Diethyl sulfite; NSC 8838 |
| CAS: | 623-81-4 |
| EINECS: | 210-815-5 |
| Molecular Formula: | C4H10 O3 S |
| Molecular Weight: | 138.18 |
| InChI: | InChI=1/C4H10O3S/c1-3-6-8(5)7-4-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.077 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.413-1.415 |
| Solubility: | Soluble |
| Appearance: | clear, colorless |
| Specification: |
Diethyl sulfite ,its CAS NO. is 623-81-4,the synonyms is Ethyl sulfite;diethyl sulfite ; Sulfurous acid diethyl ester ; Diethyl ester of sulfurous acid ; Diethyl sulphite ; Ethyl sulfite, (et2so3) ; Ethylethylsulfonate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29209085 |
| Storage Temperature: | Flammables area |
| Usage: | Used as an additive in some polymers to prevent oxidation. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
