| Identification | |
| Name: | L-Tyrosine, O-methyl- |
| Synonyms: | NSC 30082;O-Methyl-L-tyrosine;O-Methyltyrosine;p-Methoxy-L-phenylalanine;b-(4-Methoxyphenyl)-L-alanine;H-Tyr(Me)-OH;Alanine,3-(p-methoxyphenyl)-, L- (8CI);L-4-Methoxyphenylalanine;L-O-Methyltyrosine;L-Tyrosine methyl ether; |
| CAS: | 6230-11-1 |
| EINECS: | 228-333-9 |
| Molecular Formula: | C10H13NO3 |
| Molecular Weight: | 195.21512 |
| InChI: | InChI=1S/C10H13NO3/c1-14-8-4-2-7(3-5-8)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 259-261 ºC |
| Density: | 1.209 g/cm3 |
| Refractive index: | 1.559 |
| Alpha: | -8 º (C=2, 1N HCL) |
| Water Solubility: | Very soluble in water |
| Solubility: | Very soluble in water |
| Appearance: | white to off white powder |
| Specification: | white to very slightly beige powder usageEng:A non-natural Phenylalanine (P319415) derivative. Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Storage Temperature: | Store at RT. |
| Usage: | A non-natural Phenylalanine (P319415) derivative. |
| Safety Data | |
 |
|
