| Identification | |
| Name: | 4'-AMINOMETHYLTRIOXSALEN HYDROCHLORIDE |
| Synonyms: | {7H-Furo[3,2-G][1]benzopyran-7-one,} 3-(aminomethyl)-2,5, 9-trimethyl-, hydrochloride;3-(Aminomethyl)-2,5,9-trimethyl-7H-furo[3,2-G]chromen-7-one;Aids128619;Aids-128619;Nsc291836 |
| CAS: | 62442-61-9 |
| Molecular Formula: | C15H15NO3.ClH |
| Molecular Weight: | 293.748 |
| InChI: | InChI=1S/C15H15NO3/c1-7-4-13(17)19-14-8(2)15-11(5-10(7)14)12(6-16)9(3)18-15/h4-5H,6,16H2,1-3H3 |
| Molecular Structure: | ![(C15H15NO3.ClH) {7H-Furo[3,2-G][1]benzopyran-7-one,} 3-(aminomethyl)-2,5, 9-trimethyl-, hydrochloride;3-(Aminomethyl...](https://img.guidechem.com/structure/62442-61-9.gif) |
| Properties | |
| Transport: | UN 1759 8/PG 2 |
| Specification: | Safety Statements:26-27-36-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36:Wear suitable protective clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
