| Identification | |
| Name: | 2-Pentene, 2-methyl- |
| Synonyms: | 1,1-Dimethyl-1-butene;2,4-Dimethyl-2-butene; 2-Ethyl-1,1-dimethylethylene; 2-Methyl-2-pentene;4-Methyl-3-pentene; NSC 73910 |
| CAS: | 625-27-4 |
| EINECS: | 210-883-6 |
| Molecular Formula: | C6H12 |
| Molecular Weight: | 84.15948 |
| InChI: | InChI=1S/C6H12/c1-4-5-6(2)3/h5H,4H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3295 |
| Flash Point: | -27 ºC |
| Density: | 0.69 |
| Stability: | Stable. Highly flammable. Incompatible with acids, oxidizing agents. |
| Refractive index: | 1.400 |
| Water Solubility: | Insoluble in water,soluble in ethanol, ethyl ether |
| Solubility: | Insoluble in water,soluble in ethanol, ethyl ether |
| Appearance: | Colorless liquid |
| Specification: |
2-Methyl-2-pentene ,its cas register number is 625-27-4. It also can be called 2-Pentene, 2-methyl- ; Trans-2-Methyl-2-pentene ; 2-Methylpent-2-ene ; and 2-Methylpent-2-en . |
| Packinggroup: | II |
| Flash Point: | -27 ºC |
| Safety Data | |
| Hazard Symbols |
F: Flammable
Xn: Harmful
|
 |
|
