| Identification |
| Name: | 3-Chloropropionyl chloride |
| Synonyms: | - |
| CAS: | 625-36-5 |
| EINECS: | 210-890-4 |
| Molecular Formula: | C3H4Cl2O |
| Molecular Weight: | 126.97 |
| InChI: | InChI=1/C3H4Cl2O/c4-2-1-3(5)6/h1-2H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 220ks
|
| Density: | 1.33 |
| Stability: | Combines vigorously or explosively with water. |
| Refractive index: | 1.456-1.458 |
| Water Solubility: | reacts |
| Solubility: | Combines vigorously
with water
AUTOIGNITION |
| Appearance: | clear
to brown
liquid |
| Packinggroup: | I |
| HS Code: | 29159080 |
| Storage Temperature: | Flammables area |
| Sensitive: | Moisture Sensitive |
| Color: | red-brown |
| Safety Data |
| Hazard Symbols |
T+:Verytoxic
|
| |
 |
