| Identification |
| Name: | Ethanol, 2-nitro- |
| Synonyms: | 1,2-Nitroethanol;NSC 16151;b-Nitroethanol; |
| CAS: | 625-48-9 |
| EINECS: | 210-895-1 |
| Molecular Formula: | C2H5NO3 |
| Molecular Weight: | 91.07 |
| InChI: | InChI=1/C2H5NO3/c4-2-1-3(5)6/h4H,1-2H2 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | ?80 ºC(lit.) |
| Flash Point: | >230 ºF |
| Density: | 1.27 |
| Stability: | No data. |
| Refractive index: | n20/D 1.445(lit.) |
| Solubility: | Freely soluble |
| Appearance: | Mobile dark brown-red liquid with a pungent odor. |
| HS Code: | 29055910 |
| Flash Point: | >230 ºF |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
