| Identification | |
| Name: | Thiophene, 2,5-diiodo- |
| Synonyms: | 2,5-Diiodothiophene;NSC 80411 |
| CAS: | 625-88-7 |
| EINECS: | 210-915-9 |
| Molecular Formula: | C4H2 I2 S |
| Molecular Weight: | 335.934 |
| InChI: | InChI=1S/C4H2I2S/c5-3-1-2-4(6)7-3/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 37-41 °C(lit.) |
| Flash Point: | 205 °F |
| Boiling Point: | 139-140 °C(lit.) |
| Density: | 2.729g/cm3 |
| Refractive index: | 1.756 |
| Specification: | white to light yellow crystal powder Safety Statements:36/37/39-26 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 205 °F |
| Storage Temperature: | 0-6°C |
| Sensitive: | Light Sensitive |
| Safety Data | |
 |
|
