| Identification | |
| Name: | Nitroso-bux-ten |
| Synonyms: | Nitroso-bux-ten;Phenol, 3-(1-ethylpropyl)-, methylnitrosocarbamate, mixed with 3-(1-methylbutyl)phenylmethylnitrosocarbamate;AC1L47E5;LS-104652;57679-08-0;62573-59-5;N-nitroso-N-[(3-pentan-2-ylphenyl)methyl]carbamate; (3-pentan-3-ylphenyl) N-methyl-N-nitrosocarbamate |
| CAS: | 62573-59-5 |
| Molecular Formula: | C26H35N4O6- |
| Molecular Weight: | 499.5793 |
| InChI: | InChI=1S/2C13H18N2O3/c1-4-10(5-2)11-7-6-8-12(9-11)18-13(16)15(3)14-17;1-3-5-10(2)12-7-4-6-11(8-12)9-15(14-18)13(16)17/h6-10H,4-5H2,1-3H3;4,6-8,10H,3,5,9H2,1-2H3,(H,16,17)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 146.6°C |
| Boiling Point: | 318.8°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Nitroso-bux-ten , its CAS NO. is 62573-59-5, the synonyms are Phenol, 3-(1-ethylpropyl)-, methylnitrosocarbamate, mixed with 3-(1-methylbutyl)phenylmethylnitrosocarbamate ; Nitrosobux-ten . |
| Report: |
EPA Genetic Toxicology Program. EPA Genetic Toxicology Program. |
| Flash Point: | 146.6°C |
| Safety Data | |
 |
|
