| Identification | |
| Name: | BUX-Ten |
| Synonyms: | Bux;Bufencarb;Metalkamate;Phenol,3-(1-ethylpropyl)-,methylcarbamate,mixt. with 3-(1-methylbutyl)phenyl methylcarbamate;ORTHO 5353;METHYLCARBAMIC ACID-m-((1-METHYL)BUTYL)PHENYL ESTER mixed with CARBAMIC ACID, METHYL-m-(1-ETHYLPROPYL)PHENYL ESTER (3:1); |
| CAS: | 8065-36-9 |
| Molecular Formula: | C26H38N2O4 |
| Molecular Weight: | 442.59092 |
| InChI: | InChI=1S/2C13H19NO2/c1-4-6-10(2)11-7-5-8-12(9-11)16-13(15)14-3;1-4-10(5-2)11-7-6-8-12(9-11)16-13(15)14-3/h5,7-10H,4,6H2,1-3H3,(H,14,15);6-10H,4-5H2,1-3H3,(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2757 |
| Flash Point: | 132.9°C |
| Boiling Point: | 296.1°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
BUX-Ten (CAS NO.8065-36-9) is also called 3-(1-Methylbutyl)phenyl methylcarbamate and 3-(1-ethylpropyl)phenyl methylcarbamate (3:1) ; 3-(1-Methylbutyl)phenyl methylcarbamate mixed with 3-(1-ethylpropyl)phenyl methylcarbamate ; BUX insecticide ; Bufencarb ; Bufencarb [ANSI] ; Bux ; Bux 2 (8CI) ; Caswell No. 556 ; EPA Pesticide Chemical Code 059301 ; Metalcamat ; Metalkamate ; Phenol, 3-(1-ethylpropyl)-, methylcarbamate, mixt. with 3-(1-methylbutyl)phenyl methylcarbamate ; Phenol, 3-(3-pentyl)-, methylcarbamate, mixt. with 3-(2-pentyl)phenyl methylcarbamate ; m-(1-Methylbutyl)phenyl methylcarbamate and m-(ethylpropyl)phenyl methylcarbamate (3:1) . BUX-Ten (CAS NO.8065-36-9) is high toxic. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry. Keep BUX-Ten (CAS NO.8065-36-9) separate from raw materials of food. |
| Packinggroup: | III |
| Flash Point: | 132.9°C |
| Safety Data | |
 |
|
