Identification |
Name: | Oxirane, methyl-, polymer with oxirane, butanedioate |
Synonyms: | Oxirane, methyl-, polymer with oxirane, butanedioate;Bernsteinsure, ethoxiliert, propoxiliert, Molmasse >=1000 g/mol;Ethylene oxide-propylene oxide copolymer succinic acid ester;Methyl oxirane polymer with oxirane, butanedioate |
CAS: | 62683-37-8 |
Molecular Formula: | C9H16O6 |
Molecular Weight: | 220.21974 |
InChI: | InChI=1S/C4H6O4.C3H6O.C2H4O/c5-3(6)1-2-4(7)8;1-3-2-4-3;1-2-3-1/h1-2H2,(H,5,6)(H,7,8);3H,2H2,1H3;1-2H2 |
Molecular Structure: |
![(C9H16O6) Oxirane, methyl-, polymer with oxirane, butanedioate;Bernsteinsure, ethoxiliert, propoxiliert, Molma...](https://img.guidechem.com/crawlimg/62683-37-8.png) |
Properties |
Safety Data |
|
![](/images/detail_15.png) |