| Identification | |
| Name: | 1H-3-Benzazepine-7,8-diol,2,3,4,5-tetrahydro-1-phenyl-, hydrochloride (1:1) |
| Synonyms: | 1H-3-Benzazepine-7,8-diol,2,3,4,5-tetrahydro-1-phenyl-, hydrochloride (9CI); SKF 38393 hydrochloride; SKF38393A |
| CAS: | 62717-42-4 |
| Molecular Formula: | C16H17 N O2 . Cl H |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C16H17NO2.ClH/c18-15-8-12-6-7-17-10-14(13(12)9-16(15)19)11-4-2-1-3-5-11;/h1-5,8-9,14,17-19H,6-7,10H2;1H |
| Molecular Structure: |  |
| Properties | |
| Specification: | Safety Statements:22-26-36 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
 |
|
