| Identification | |
| Name: | 4-Piperidinone,1-cyclopropyl- |
| Synonyms: | 1-Cyclopropyl-4-piperidinone;1-Cyclopropyl-4-piperidone;1-Cyclopropyltetrahydro-4(1H)-pyridinone; |
| CAS: | 62813-01-8 |
| Molecular Formula: | C8H13NO |
| Molecular Weight: | 139.19 |
| InChI: | InChI=1/C8H13NO/c10-8-3-5-9(6-4-8)7-1-2-7/h7H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.151 g/cm3 |
| Refractive index: | 1.552 |
| Specification: |
The cas register number of 1-Cyclopropylpiperidin-4-one is 62813-01-8. It also can be called as 4-Piperidinone,1-cyclopropyl- and the Systematic name about this chemical is 1-cyclopropylpiperidin-4-one. Physical properties about 1-Cyclopropylpiperidin-4-one are: (1)ACD/LogP: 0.32; (2)ACD/LogD (pH 5.5): -3; (3)ACD/LogD (pH 7.4): -1; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 4; (8)#H bond acceptors: 2; (9)#Freely Rotating Bonds: 1; (10)Polar Surface Area: 20.31Å2; (11)Index of Refraction: 1.552; (12)Molar Refractivity: 38.634 cm3; (13)Molar Volume: 120.904 cm3; (14)Polarizability: 15.316x10-24cm3; (15)Surface Tension: 49.57 dyne/cm; (16)Enthalpy of Vaporization: 47.101 kJ/mol; (17)Boiling Point: 234.271 °C at 760 mmHg; (18)Vapour Pressure: 0.053 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
