| Identification | |
| Name: | 9H-Purine,6-(propylthio)- |
| Synonyms: | 1H-Purine,6-(propylthio)- (9CI); Purine, 6-(propylthio)- (6CI,7CI,8CI);6-(Propylthio)purine; 6-n-Propylmercaptopurine; NSC 11595 |
| CAS: | 6288-93-3 |
| Molecular Formula: | C8H10 N4 S |
| Molecular Weight: | 194.28 |
| InChI: | InChI=1/C8H10N4S/c1-2-3-13-8-6-7(10-4-9-6)11-5-12-8/h4-6H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 144.6°C |
| Boiling Point: | 315.5°C at 760 mmHg |
| Density: | 1.42g/cm3 |
| Refractive index: | 1.722 |
| Specification: |
6-(Propylthio)purine , its cas register number is 6288-93-3. It also can be called 6-Propyl-MP ; 6-n-Propylthiopurine ; and 1H-Purine, 6-(propylthio)- . |
| Flash Point: | 144.6°C |
| Safety Data | |
 |
|
