| Identification | |
| Name: | L-Phenylalanine |
| Synonyms: | beta-Phenylalnine, (-)-;Alanine, phenyl-;(-)-.beta.-Phenylalanine;(2S)-2-azaniumyl-3-phenyl-propanoate;(S)-Phenylalanine;alpha-Amino-beta-phenylpropionic acid, L-;(S)-alpha-Aminohydrocinnamic acid;beta-phenylalanine;L-.beta.-Phenylalanine;(2S)-2-amino-3-phenyl-propanoic acid;Phenylalamine;L-Antibiotic FN 1636;2-Amino-3-phenylpropionic acid, L-;Phenylalanine (USP);Hydrocinnamic acid, alpha-amino-;(L)-Phenylalanine;Alanine, phenyl-, L-;L-Phenylalanine (JP14); |
| CAS: | 63-91-2 |
| EINECS: | 200-568-1 |
| Molecular Formula: | C9H11NO2 |
| Molecular Weight: | 165.19 |
| InChI: | InChI:1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.201 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Alpha: | -34.1 o (C=2, WATER, DRY BASIS) |
| Water Solubility: | 1-5 G/100 ML AT 25 oC |
| Solubility: | 1-5 g/100 mL at 25 oC |
| Appearance: | White crystalline powder |
| Specification: | White crystalline powder Safety Statements:22-24/25-37/39-45-36/37/39-27-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 27:Take off immediately all contaminated clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29224995 |
| Storage Temperature: | Store at RT. |
| Color: | Prisms form water Monoclinic plates, leaflets from warm concentrated aqueous solution; hydrated needles from dilute solutions |
| Usage: | Component of the artifical sweetener aspartame nutrient. |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
