| Identification | |
| Name: | Benz(a)anthracene-7-methanethiol |
| Synonyms: | Benz[a]anthracene-7-methanethiol |
| CAS: | 63018-59-7 |
| Molecular Formula: | C19H14S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C19H14S/c20-12-19-16-8-4-2-6-14(16)11-18-15-7-3-1-5-13(15)9-10-17(18)19/h1-11,20H,12H2 |
| Molecular Structure: | ![(C19H14S) Benz[a]anthracene-7-methanethiol](https://img.guidechem.com/crawlimg/63018-59-7.png) |
| Properties | |
| Flash Point: | 211.7°C |
| Boiling Point: | 507.6°C at 760 mmHg |
| Density: | 1.235g/cm3 |
| Refractive index: | 1.773 |
| Specification: |
Benz(a)anthracene-7-methanethiol , its CAS number is 63018-59-7, it can be called 1,2-Benzanthryl-10-methylmercaptan . It is a toxic substance, with flammability, burning will produce toxic fumes of sulfur oxides, so it should be stored in cool and dry environment, dry powder, foam, sand, carbon dioxide, water mist can be used if something urgent happened. |
| Flash Point: | 211.7°C |
| Safety Data | |
 |
|
