| Identification | |
| Name: | 9-Methyl-10-cyano-1,2-benzanthracene |
| Synonyms: | 12-Methylbenz[a]anthracene-7-carbonitrile |
| CAS: | 63020-25-7 |
| Molecular Formula: | C20H14N |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C20H13N/c1-13-15-7-4-5-9-17(15)19(12-21)18-11-10-14-6-2-3-8-16(14)20(13)18/h2-11H,1H3 |
| Molecular Structure: | ![(C20H14N) 12-Methylbenz[a]anthracene-7-carbonitrile](https://img.guidechem.com/crawlimg/63020-25-7.png) |
| Properties | |
| Flash Point: | 267.7°C |
| Boiling Point: | 515.5°C at 760 mmHg |
| Density: | 1.22g/cm3 |
| Refractive index: | 1.75 |
| Specification: |
9-Methyl-10-cyano-1,2-benzanthracene (CAS NO.63020-25-7) is also called as 7-Cyano-12-methylbenz(a)anthracene ; Benz(a)anthracene, 7-cyano-12-methyl- . |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 267.7°C |
| Safety Data | |
 |
|
