| Identification | |
| Name: | 2-ethylhexanoic acid, compound with N-(2-aminoethyl)ethane-1,2-diamine |
| Synonyms: | Hexanoic acid, 2-ethyl-, compd. with N1-(2-aminoethyl)-1,2-ethanediamine (1:?);2-Ethylhexanoic acid, compound with N-(2-aminoethyl)ethane-1,2-diamine;Hexanoic acid, 2-ethyl-, compd. with N-(2-aminoethyl)-1,2-ethanediamine;2-ethylhexanoic acid - N-(2-aminoethyl)ethane-1,2-diamine (1:1) |
| CAS: | 63428-89-7 |
| EINECS: | 264-139-0 |
| Molecular Formula: | C12H29N3O2 |
| Molecular Weight: | 247.3776 |
| InChI: | InChI=1/C8H16O2.C4H13N3/c1-3-5-6-7(4-2)8(9)10;5-1-3-7-4-2-6/h7H,3-6H2,1-2H3,(H,9,10);7H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 116.6°C |
| Boiling Point: | 228°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 116.6°C |
| Safety Data | |
 |
|
