| Identification | |
| Name: | butyl prop-2-enoate; ethenyl acetate; 2-methylidenebutanedioic acid |
| Synonyms: | AC1O59R2;Butanedioic acid, methylene-, polymer with butyl 2-propenoate and ethenyl acetate;butyl prop-2-enoate; ethenyl acetate; 2-methylidenebutanedioic acid;Butanedioic acid, 2-methylene-, polymer with butyl 2-propenoate and ethenyl acetate;63450-13-5 |
| CAS: | 63450-13-5 |
| Molecular Formula: | C16H24O8 |
| Molecular Weight: | 344.35696 |
| InChI: | InChI=1S/C7H12O2.C5H6O4.C4H6O2/c1-3-5-6-9-7(8)4-2;1-3(5(8)9)2-4(6)7;1-3-6-4(2)5/h4H,2-3,5-6H2,1H3;1-2H2,(H,6,7)(H,8,9);3H,1H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 39.4°C |
| Boiling Point: | 145.9°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 39.4°C |
| Safety Data | |
 |
|
