| Identification |
| Name: | butyl prop-2-enoate; dimethyl (Z)-but-2-enedioate; vinyl acetate |
| Synonyms: | AC1O5BSS;2-Butenedioic acid (2Z)-, dimethyl ester, polymer with butyl 2-propenoate and ethenyl acetate;Vinyl acetate, polymer with butylacrylate and dimethyl maleate;butyl prop-2-enoate; dimethyl (Z)-but-2-enedioate; ethenyl acetate;2-Butenedioic acid (2Z)-, 1,4-dimethyl ester, polymer with butyl 2-propenoate and ethenyl acetate;67859-83-0 |
| CAS: | 67859-83-0 |
| Molecular Formula: | C17H26O8 |
| Molecular Weight: | 358.3835 |
| InChI: | InChI=1/C7H12O2.C6H8O4.C4H6O2/c1-3-5-6-9-7(8)4-2;1-9-5(7)3-4-6(8)10-2;1-3-6-4(2)5/h4H,2-3,5-6H2,1H3;3-4H,1-2H3;3H,1H2,2H3/b;4-3-; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 91.1°C |
| Boiling Point: | 193°C at 760 mmHg |
| Flash Point: | 91.1°C |
| Safety Data |
| |
 |
