Identification |
Name: | chloroethylene; diethyl (Z)-but-2-enedioate; vinyl acetate |
Synonyms: | AC1O5ALP;2-Butenedioic acid (2Z)-, diethyl ester, polymer with chloroethene and ethenyl acetate;chloroethene; diethyl (Z)-but-2-enedioate; ethenyl acetate;2-Butenedioic acid (2Z)-, 1,4-diethyl ester, polymer with chloroethene and ethenyl acetate;65072-38-0 |
CAS: | 65072-38-0 |
Molecular Formula: | C14H21ClO6 |
Molecular Weight: | 320.7659 |
InChI: | InChI=1/C8H12O4.C4H6O2.C2H3Cl/c1-3-11-7(9)5-6-8(10)12-4-2;1-3-6-4(2)5;1-2-3/h5-6H,3-4H2,1-2H3;3H,1H2,2H3;2H,1H2/b6-5-;; |
Molecular Structure: |
|
Properties |
Flash Point: | 93.3°C |
Boiling Point: | 214°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 93.3°C |
Safety Data |
|
|