| Identification | |
| Name: | Benzeneethanamine,3,4-dimethoxy-, hydrochloride (1:1) |
| Synonyms: | Benzeneethanamine,3,4-dimethoxy-, hydrochloride (9CI); Phenethylamine, 3,4-dimethoxy-, hydrochloride(6CI,8CI); 2-(3,4-Dimethoxyphenyl)ethylamine hydrochloride;3,4-Dimethoxyphenethylamine hydrochloride; Homoveratrylamine hydrochloride; b-(3,4-Dimethoxyphenyl)ethylaminehydrochloride |
| CAS: | 635-85-8 |
| Molecular Formula: | C10H15 N O2 . Cl H |
| Molecular Weight: | 217.6925 |
| InChI: | InChI=1/C10H15NO2.ClH/c1-12-9-4-3-8(5-6-11)7-10(9)13-2;/h3-4,7H,5-6,11H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Specification: |
3,4-Dimethoxyphenethylamine hydrochloride , its cas register number is 635-85-8. It also can be called 3,4-Dimethoxy-beta-phenylethylamine hydrochloride ; Phenethylamine, 3,4-dimethoxy-, hydrochloride ; and Benzeneethanamine, 3,4-dimethoxy-, hydrochloride (9CI) . |
| Safety Data | |
 |
|
