| Identification | |
| Name: | 7-Methylbenz(a)anthracene-10-carbonitrile |
| Synonyms: | 7-Methylbenz[a]anthracene-10-carbonitrile |
| CAS: | 6366-23-0 |
| Molecular Formula: | C20H13N |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C20H13N/c1-13-17-8-6-14(12-21)10-16(17)11-20-18(13)9-7-15-4-2-3-5-19(15)20/h2-11H,1H3 |
| Molecular Structure: | ![(C20H13N) 7-Methylbenz[a]anthracene-10-carbonitrile](https://img.guidechem.com/crawlimg/6366-23-0.png) |
| Properties | |
| Flash Point: | 267.7°C |
| Boiling Point: | 515.5°C at 760 mmHg |
| Density: | 1.22g/cm3 |
| Refractive index: | 1.75 |
| Specification: |
7-Methylbenz(a)anthracene-10-carbonitrile ,with CAS number of 6366-23-0,can be called BRN 2587415 ; 7-Cyano-10-methyl-1,2-benzanthracene . |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. 7-Methylbenz(a)anthracene-10-carbonitrile (CAS NO.6366-23-0) was reported in JNCIAM Journal of the National Cancer Institute. |
| Flash Point: | 267.7°C |
| Safety Data | |
 |
|
