| Identification | |
| Name: | 5-Methoxy-7-methylbenz(a)anthracene |
| Synonyms: | 5-Methoxy-7-methylbenz[a]anthracene |
| CAS: | 966-48-3 |
| Molecular Formula: | C20H16O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C20H16O/c1-13-15-8-4-3-7-14(15)11-19-16-9-5-6-10-17(16)20(21-2)12-18(13)19/h3-12H,1-2H3 |
| Molecular Structure: | ![(C20H16O) 5-Methoxy-7-methylbenz[a]anthracene](https://img.guidechem.com/crawlimg/966-48-3.png) |
| Properties | |
| Flash Point: | 198.7°C |
| Boiling Point: | 481.5°C at 760 mmHg |
| Density: | 1.173g/cm3 |
| Refractive index: | 1.716 |
| Specification: |
5-Methoxy-7-methylbenz(a)anthracene , its cas register number is 966-48-3. It also can be called 3-Methoxy-10-methyl-1,2-benzanthracene ; BRN 2563813 ; and Benz(a)anthracene, 5-methoxy-7-methyl- . |
| Flash Point: | 198.7°C |
| Safety Data | |
 |
|
