| Identification | |
| Name: | 2-Furanmethanol,tetrahydro-, 2-acetate |
| Synonyms: | 2-Furanmethanol,tetrahydro-, acetate (9CI);Furfuryl alcohol, tetrahydro-, acetate(6CI,7CI,8CI);2-(Acetoxymethyl)oxolane;2-(Acetoxymethyl)tetrahydrofuran;NSC4872;Tetrahydrofurfuryl acetate; |
| CAS: | 637-64-9 |
| EINECS: | 211-296-8 |
| Molecular Formula: | C7H12O3 |
| Molecular Weight: | 144.16838 |
| InChI: | InChI=1S/C7H12O3/c1-6(8)10-5-7-3-2-4-9-7/h7H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 193 |
| Refractive index: | n20/D 1.437(lit.) |
| Water Solubility: | Soluble in water, ether, chloroform |
| Solubility: | Soluble in water, ether, chloroform |
| Specification: |
2-Furanmethanol,tetrahydro-, 2-acetate , with CAS number of 637-64-9, can be called 2-tetrahydrofurfurylacetate ; aceticacidtetrahydro-furfurylester ; tetrahydro-2-furanmethanoacetate ; 2-(Acetoxymethyl)oxolane ; 2-(acetoxymethyl)tetrahydrofuran ; tetrahydrofurfuryl acetate ; tetrahydro-2-furanmethanol acetate . |
| Safety Data | |
 |
|
