| Identification | |
| Name: | 2-Furanmethanol,tetrahydro-, 2-propanoate |
| Synonyms: | 2-Furanmethanol,tetrahydro-, propanoate (9CI); Furfuryl alcohol, tetrahydro-, propionate (8CI);Propionic acid, tetrahydrofurfuryl ester (6CI); ENT 4296; Tetrahydrofurfurylpropionate |
| CAS: | 637-65-0 |
| EINECS: | 211-297-3 |
| Molecular Formula: | C8H14 O3 |
| Molecular Weight: | 158.19496 |
| InChI: | InChI=1S/C8H14O3/c1-2-8(9)11-6-7-4-3-5-10-7/h7H,2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.04 |
| Refractive index: | 1.438 |
| Water Solubility: | Insoluble in water; soluble in alcohol. |
| Solubility: | Insoluble in water; soluble in alcohol. |
| Appearance: | colorless liquid |
| Specification: |
2-Furanmethanol,tetrahydro-, 2-propanoate , with CAS number of 637-65-0, can be called Propionic acid tetrahydrofurfuryl ester ; tetrahydrofurfuryl propionate ; 2-furanemethanol, tetrahydro-, propanoate ; 2-furanmethanol, tetrahydro-, propanoate ; tetrahydro-2-furanmethanopropanoate ; tetrahydro-2-furanylmethyl propionate ; tetrahydrofurfuryl alcohol propionate ; tetrahydrofurfurylpropanoate . |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
