| Identification | |
| Name: | Ethoxyethyl ether of propylene glycol |
| Synonyms: | 1-(2-ethoxyethoxy)propan-2-ol;3-(2-Ethoxyethoxy)-2-propanol |
| CAS: | 63716-10-9 |
| Molecular Formula: | C7H16O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C7H16O3/c1-3-9-4-5-10-6-7(2)8/h7-8H,3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 80.9°C |
| Boiling Point: | 210.1°Cat760mmHg |
| Density: | 0.958g/cm3 |
| Specification: |
Ethoxyethyl ether of propylene glycol , its cas register number is 63716-10-9. It also can be called Ethoxyethylether propylenglykolu ; 2-Propanol, 3-(2-ethoxy)ethoxy- ; and Ether, (2-hydroxy)propyl (2-ethoxy)ethyl . |
| Report: |
Glycol ether compounds are on the Community Right-To-Know List. |
| Flash Point: | 80.9°C |
| Safety Data | |
 |
|
