| Identification | |
| Name: | 1H-Benzimidazol-6-amine,2-(4-aminophenyl)-, hydrochloride (1:2) |
| Synonyms: | 1H-Benzimidazol-5-amine,2-(4-aminophenyl)-, dihydrochloride (9CI) |
| CAS: | 63991-49-1 |
| Molecular Formula: | C13H12 N4 . 2 Cl H |
| Molecular Weight: | 297.21 |
| InChI: | InChI=1/C13H12N4.2ClH/c14-9-3-1-8(2-4-9)13-16-11-6-5-10(15)7-12(11)17-13;;/h1-7H,14-15H2,(H,16,17);2*1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 317.6°C |
| Boiling Point: | 545.5°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
6-Amino-2-(4'-aminophenyl)benzimidazole dihydrochloride , its cas register number is 63991-49-1. It also can be called 6-Amino-2-(4'-aminofenyl)benzimidazol hydrochlorid ; 6-Amino-2-(p-aminofenyl)benzimidazol dichlorid . 6-Amino-2-(4'-aminophenyl)benzimidazole dihydrochloride (CAS NO.63991-49-1) will cause a severe eye irritant. When heated to decomposition it emits very toxic fumes of HCl and NOx. |
| Flash Point: | 317.6°C |
| Safety Data | |
 |
|
