| Identification | |
| Name: | 2-(4-aminophenyl)-1H-benzimidazol-2-amine |
| Synonyms: | APBIA; 2-(4-Aminophenyl)-5-aminobenzimidazole |
| CAS: | 7621-86-5 |
| EINECS: | 231-538-6 |
| Molecular Formula: | C13H12N4 |
| Molecular Weight: | 224.26 |
| InChI: | InChI=1/C13H12N4/c14-9-3-1-8(2-4-9)13-16-11-6-5-10(15)7-12(11)17-13/h1-7H,14-15H2,(H,16,17) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.359 g/cm3 |
| Refractive index: | 1.787 |
| Specification: |
2-(4-Aminophenyl)-5-aminobenzimidazole ,its cas register number is 7621-86-5.It also can be called 2-(4-Amino-phenyl)-3H-benzoimidazol-5-ylamine ; 2-(4-Amino-phenyl)-1H-benzoimidazol-5-ylamine ; 2-(4-Aminophenyl)-1H-benzimidazol-2-amine and 1H-Benzimidazol-5-amine, 2- (4-aminophenyl)- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
