Identification |
Name: | 5-Isobenzofurancarbonitrile,1-(4-fluorophenyl)-1,3-dihydro- |
Synonyms: | 1-(4-Fluorophenyl)-1,3-dihydroisobenzofuran-5-carbonitrile;1-(4-Fluorophenyl)-5-cyanophthalan;5-Cyano-1-(4-Fluorophenyl)-1,3-dihydroisobenzofuran;LU 17-046; |
CAS: | 64169-67-1 |
Molecular Formula: | C15H10FNO |
Molecular Weight: | 239.24 |
InChI: | InChI=1/C15H10FNO/c16-13-4-2-11(3-5-13)15-14-6-1-10(8-17)7-12(14)9-18-15/h1-7,15H,9H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 180.8 ºC |
Density: | 1.29 |
Refractive index: | 1.62 |
Appearance: | white to light yellow crystal powder |
Specification: | white to light yellow crystal powde usageEng:An intermediate in the synthesis of Citalopram |
Flash Point: | 180.8 ºC |
Usage: | An intermediate in the synthesis of Citalopram |
Safety Data |
|
 |